C24H28N4O — CID 24632316
(E)-2-(4-benzylpiperazine-1-carbonyl)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enenitrile (PubChem CID 24632316) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is (E)-2-(4-benzylpiperazine-1-carbonyl)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-benzylpiperazine-1-carbonyl)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 24632316 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (E)-2-(4-benzylpiperazine-1-carbonyl)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)N2CCN(Cc3ccccc3)CC2)c(C)n1C1CC1 |
| InChI | InChI=1S/C24H28N4O/c1-18-14-21(19(2)28(18)23-8-9-23)15-22(16-25)24(29)27-12-10-26(11-13-27)17-20-6-4-3-5-7-20/h3-7,14-15,23H,8-13,17H2,1-2H3/b22-15+ |
| InChIKey | SMJDTHBDPABDHG-PXLXIMEGSA-N |
| XLogP | 3.69 |
| TPSA | 52.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|