C22H25N3O — CID 2874463
2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-phenylprop-2-enamide (PubChem CID 2874463) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-phenylprop-2-enamide.
| Compound Name | 2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 2874463 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-phenylprop-2-enamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)Nc2ccccc2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C22H25N3O/c1-16-13-18(17(2)25(16)21-11-7-4-8-12-21)14-19(15-23)22(26)24-20-9-5-3-6-10-20/h3,5-6,9-10,13-14,21H,4,7-8,11-12H2,1-2H3,(H,24,26) |
| InChIKey | GWGZBBRATIKFLZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|