C24H29N3O — CID 29098179
(E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-(2,6-dimethylphenyl)prop-2-enamide (PubChem CID 29098179) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is (E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-(2,6-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-(2,6-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 29098179 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-(2,6-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(C)c1NC(=O)/C(C#N)=C/c1cc(C)n(C2CCCCC2)c1C |
| InChI | InChI=1S/C24H29N3O/c1-16-9-8-10-17(2)23(16)26-24(28)21(15-25)14-20-13-18(3)27(19(20)4)22-11-6-5-7-12-22/h8-10,13-14,22H,5-7,11-12H2,1-4H3,(H,26,28)/b21-14+ |
| InChIKey | RIDRMAVJRCMIDD-KGENOOAVSA-N |
| XLogP | 5.77 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|