C25H27N5OS — CID 86904203
(Z)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide (PubChem CID 86904203) has the molecular formula C25H27N5OS and a molecular weight of 445.59 g/mol. Its IUPAC name is (Z)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 86904203 |
| Molecular Formula | C25H27N5OS |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (Z)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)NCc2nc(-c3ccncc3)cs2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C25H27N5OS/c1-17-12-20(18(2)30(17)22-6-4-3-5-7-22)13-21(14-26)25(31)28-15-24-29-23(16-32-24)19-8-10-27-11-9-19/h8-13,16,22H,3-7,15H2,1-2H3,(H,28,31)/b21-13- |
| InChIKey | VFEQQRUJRPZDDA-BKUYFWCQSA-N |
| XLogP | 5.35 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|