C23H22N4OS — CID 24675873
(E)-2-cyano-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]prop-2-enamide (PubChem CID 24675873) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is (E)-2-cyano-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24675873 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (E)-2-cyano-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)NCc2csc(-c3ccccc3)n2)c(C)n1C1CC1 |
| InChI | InChI=1S/C23H22N4OS/c1-15-10-18(16(2)27(15)21-8-9-21)11-19(12-24)22(28)25-13-20-14-29-23(26-20)17-6-4-3-5-7-17/h3-7,10-11,14,21H,8-9,13H2,1-2H3,(H,25,28)/b19-11+ |
| InChIKey | DIGKMSCFZBXVJP-YBFXNURJSA-N |
| XLogP | 4.79 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|