C24H26N2O3 — CID 7961499
phenacyl (E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate (PubChem CID 7961499) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is phenacyl (E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate.
| Compound Name | phenacyl (E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7961499 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | phenacyl (E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OCC(=O)c2ccccc2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C24H26N2O3/c1-17-13-20(18(2)26(17)22-11-7-4-8-12-22)14-21(15-25)24(28)29-16-23(27)19-9-5-3-6-10-19/h3,5-6,9-10,13-14,22H,4,7-8,11-12,16H2,1-2H3/b21-14+ |
| InChIKey | MQOFPHZHQUTBOW-KGENOOAVSA-N |
| XLogP | 4.94 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|