C22H24N2O3 — CID 7837280
phenacyl (E)-3-(1-butyl-2,5-dimethylpyrrol-3-yl)-2-cyanoprop-2-enoate (PubChem CID 7837280) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is phenacyl (E)-3-(1-butyl-2,5-dimethylpyrrol-3-yl)-2-cyanoprop-2-enoate.
| Compound Name | phenacyl (E)-3-(1-butyl-2,5-dimethylpyrrol-3-yl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 7837280 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | phenacyl (E)-3-(1-butyl-2,5-dimethylpyrrol-3-yl)-2-cyanoprop-2-enoate |
| SMILES | CCCCn1c(C)cc(/C=C(\C#N)C(=O)OCC(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C22H24N2O3/c1-4-5-11-24-16(2)12-19(17(24)3)13-20(14-23)22(26)27-15-21(25)18-9-7-6-8-10-18/h6-10,12-13H,4-5,11,15H2,1-3H3/b20-13+ |
| InChIKey | UFEZJHZELDKVDA-DEDYPNTBSA-N |
| XLogP | 4.24 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|