C24H28N4O4 — CID 24526476
[2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate (PubChem CID 24526476) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate.
| Compound Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 24526476 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)OCC(=O)N(CCC(N)=O)c2ccccc2)c1C |
| InChI | InChI=1S/C24H28N4O4/c1-4-11-27-17(2)13-19(18(27)3)14-20(15-25)24(31)32-16-23(30)28(12-10-22(26)29)21-8-6-5-7-9-21/h5-9,13-14H,4,10-12,16H2,1-3H3,(H2,26,29)/b20-14+ |
| InChIKey | ZPESJPKIGLOPBW-XSFVSMFZSA-N |
| XLogP | 2.87 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|