C24H28FN3O3 — CID 27968312
[2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate (PubChem CID 27968312) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is [2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate.
| Compound Name | [2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 27968312 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | [2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)OCC(=O)N(CC)Cc2cccc(F)c2)c1C |
| InChI | InChI=1S/C24H28FN3O3/c1-5-10-28-17(3)11-20(18(28)4)13-21(14-26)24(30)31-16-23(29)27(6-2)15-19-8-7-9-22(25)12-19/h7-9,11-13H,5-6,10,15-16H2,1-4H3/b21-13+ |
| InChIKey | PIZBZEMMOWWDKU-FYJGNVAPSA-N |
| XLogP | 4.15 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|