C23H32N6O — CID 86935731
(E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide (PubChem CID 86935731) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is (E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 86935731 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | (E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)NCCc2nncn2C(C)C)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C23H32N6O/c1-16(2)28-15-26-27-22(28)10-11-25-23(30)20(14-24)13-19-12-17(3)29(18(19)4)21-8-6-5-7-9-21/h12-13,15-16,21H,5-11H2,1-4H3,(H,25,30)/b20-13+ |
| InChIKey | OSPSSRUGTDDTLC-DEDYPNTBSA-N |
| XLogP | 4.05 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|