C25H34N6O — CID 86899018
(E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-[4-(4-ethyl-1,2,4-triazol-3-yl)piperidine-1-carbonyl]prop-2-enenitrile (PubChem CID 86899018) has the molecular formula C25H34N6O and a molecular weight of 434.59 g/mol. Its IUPAC name is (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-[4-(4-ethyl-1,2,4-triazol-3-yl)piperidine-1-carbonyl]prop-2-enenitrile.
| Compound Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-[4-(4-ethyl-1,2,4-triazol-3-yl)piperidine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 86899018 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-[4-(4-ethyl-1,2,4-triazol-3-yl)piperidine-1-carbonyl]prop-2-enenitrile |
| SMILES | CCn1cnnc1C1CCN(C(=O)/C(C#N)=C/c2cc(C)n(C3CCCCC3)c2C)CC1 |
| InChI | InChI=1S/C25H34N6O/c1-4-29-17-27-28-24(29)20-10-12-30(13-11-20)25(32)22(16-26)15-21-14-18(2)31(19(21)3)23-8-6-5-7-9-23/h14-15,17,20,23H,4-13H2,1-3H3/b22-15+ |
| InChIKey | LTMOFGKIPCHIHD-PXLXIMEGSA-N |
| XLogP | 4.53 |
| TPSA | 79.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|