C25H36N4O3 — CID 86882809
ethyl N-[1-[(E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]piperidin-4-yl]-N-methylcarbamate (PubChem CID 86882809) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is ethyl N-[1-[(E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]piperidin-4-yl]-N-methylcarbamate.
| Compound Name | ethyl N-[1-[(E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]piperidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 86882809 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | ethyl N-[1-[(E)-2-cyano-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]piperidin-4-yl]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)C1CCN(C(=O)/C(C#N)=C/c2cc(C)n(C3CCCCC3)c2C)CC1 |
| InChI | InChI=1S/C25H36N4O3/c1-5-32-25(31)27(4)22-11-13-28(14-12-22)24(30)21(17-26)16-20-15-18(2)29(19(20)3)23-9-7-6-8-10-23/h15-16,22-23H,5-14H2,1-4H3/b21-16+ |
| InChIKey | UWDRNJMLSJNRGJ-LTGZKZEYSA-N |
| XLogP | 4.60 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|