C24H28N6O — CID 86935700
(E)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide (PubChem CID 86935700) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is (E)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 86935700 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (E)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[2-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=C(\C#N)C(=O)NCCc3nncn3C(C)C)c2C)cc1 |
| InChI | InChI=1S/C24H28N6O/c1-16(2)29-15-27-28-23(29)10-11-26-24(31)21(14-25)13-20-12-18(4)30(19(20)5)22-8-6-17(3)7-9-22/h6-9,12-13,15-16H,10-11H2,1-5H3,(H,26,31)/b21-13+ |
| InChIKey | ZLBNEBBTZJTFLT-FYJGNVAPSA-N |
| XLogP | 3.84 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|