C21H21BrN4O — CID 108849125
(Z)-3-[(4-bromo-2-pyridinyl)amino]-2-cyano-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide (PubChem CID 108849125) has the molecular formula C21H21BrN4O and a molecular weight of 425.33 g/mol. Its IUPAC name is (Z)-3-[(4-bromo-2-pyridinyl)amino]-2-cyano-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-[(4-bromo-2-pyridinyl)amino]-2-cyano-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108849125 |
| Molecular Formula | C21H21BrN4O |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (Z)-3-[(4-bromo-2-pyridinyl)amino]-2-cyano-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C\Nc1cc(Br)ccn1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C21H21BrN4O/c1-14(16-7-6-15-4-2-3-5-17(15)10-16)26-21(27)18(12-23)13-25-20-11-19(22)8-9-24-20/h6-11,13-14H,2-5H2,1H3,(H,24,25)(H,26,27)/b18-13- |
| InChIKey | XLFOJWAFUQPWCT-AQTBWJFISA-N |
| XLogP | 4.42 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|