C14H10F2N4O2S — CID 7934361
1-[(Z)-(2,6-difluorophenyl)methylideneamino]-3-(2-nitrophenyl)thiourea (PubChem CID 7934361) has the molecular formula C14H10F2N4O2S and a molecular weight of 336.32 g/mol. Its IUPAC name is 1-[(Z)-(2,6-difluorophenyl)methylideneamino]-3-(2-nitrophenyl)thiourea.
| Compound Name | 1-[(Z)-(2,6-difluorophenyl)methylideneamino]-3-(2-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 7934361 |
| Molecular Formula | C14H10F2N4O2S |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 1-[(Z)-(2,6-difluorophenyl)methylideneamino]-3-(2-nitrophenyl)thiourea |
| SMILES | O=[N+]([O-])c1ccccc1NC(=S)N/N=C\c1c(F)cccc1F |
| InChI | InChI=1S/C14H10F2N4O2S/c15-10-4-3-5-11(16)9(10)8-17-19-14(23)18-12-6-1-2-7-13(12)20(21)22/h1-8H,(H2,18,19,23)/b17-8- |
| InChIKey | DXIRJXXITZHXEZ-IUXPMGMMSA-N |
| XLogP | 3.19 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|