C14H10ClN5O4S — CID 3136982
N'-(3-chloro-1-benzothiophene-2-carbonyl)-1-methyl-4-nitropyrazole-3-carbohydrazide (PubChem CID 3136982) has the molecular formula C14H10ClN5O4S and a molecular weight of 379.79 g/mol. Its IUPAC name is N'-(3-chloro-1-benzothiophene-2-carbonyl)-1-methyl-4-nitropyrazole-3-carbohydrazide.
| Compound Name | N'-(3-chloro-1-benzothiophene-2-carbonyl)-1-methyl-4-nitropyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 3136982 |
| Molecular Formula | C14H10ClN5O4S |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | N'-(3-chloro-1-benzothiophene-2-carbonyl)-1-methyl-4-nitropyrazole-3-carbohydrazide |
| SMILES | Cn1cc([N+](=O)[O-])c(C(=O)NNC(=O)c2sc3ccccc3c2Cl)n1 |
| InChI | InChI=1S/C14H10ClN5O4S/c1-19-6-8(20(23)24)11(18-19)13(21)16-17-14(22)12-10(15)7-4-2-3-5-9(7)25-12/h2-6H,1H3,(H,16,21)(H,17,22) |
| InChIKey | HUEBWUGCIKNOIN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|