C16H10Cl2N2O3S — CID 135822327
3,6-dichloro-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 135822327) has the molecular formula C16H10Cl2N2O3S and a molecular weight of 381.24 g/mol. Its IUPAC name is 3,6-dichloro-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135822327 |
| Molecular Formula | C16H10Cl2N2O3S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 3,6-dichloro-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1O)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C16H10Cl2N2O3S/c17-9-2-4-11-13(5-9)24-15(14(11)18)16(23)20-19-7-8-1-3-10(21)6-12(8)22/h1-7,21-22H,(H,20,23)/b19-7+ |
| InChIKey | RUSUGXSETZXMBB-FBCYGCLPSA-N |
| XLogP | 4.38 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|