C22H16Cl2N2O3S — CID 135822006
3,6-dichloro-N-[(E)-(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 135822006) has the molecular formula C22H16Cl2N2O3S and a molecular weight of 459.35 g/mol. Its IUPAC name is 3,6-dichloro-N-[(E)-(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(E)-(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135822006 |
| Molecular Formula | C22H16Cl2N2O3S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 3,6-dichloro-N-[(E)-(2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C/c1c(O)ccc2oc3c(c12)CCCC3)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C22H16Cl2N2O3S/c23-11-5-6-13-18(9-11)30-21(20(13)24)22(28)26-25-10-14-15(27)7-8-17-19(14)12-3-1-2-4-16(12)29-17/h5-10,27H,1-4H2,(H,26,28)/b25-10+ |
| InChIKey | ZJQUYKBZFYWFCO-KIBLKLHPSA-N |
| XLogP | 6.30 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|