C22H17BrN2O4S — CID 2311570
N-[(3-bromo-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-3-hydroxy-1-benzothiophene-2-carboxamide (PubChem CID 2311570) has the molecular formula C22H17BrN2O4S and a molecular weight of 485.36 g/mol. Its IUPAC name is N-[(3-bromo-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-3-hydroxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(3-bromo-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-3-hydroxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2311570 |
| Molecular Formula | C22H17BrN2O4S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | N-[(3-bromo-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-3-hydroxy-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NN=Cc1c(O)c(Br)cc2oc3c(c12)CCCC3)c1sc2ccccc2c1O |
| InChI | InChI=1S/C22H17BrN2O4S/c23-14-9-16-18(11-5-1-3-7-15(11)29-16)13(19(14)26)10-24-25-22(28)21-20(27)12-6-2-4-8-17(12)30-21/h2,4,6,8-10,26-27H,1,3,5,7H2,(H,25,28) |
| InChIKey | XZDVUTKIGIXGAN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|