C28H21BrN4O3S — CID 137060036
N-[(E)-(3-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)benzamide (PubChem CID 137060036) has the molecular formula C28H21BrN4O3S and a molecular weight of 573.47 g/mol. Its IUPAC name is N-[(E)-(3-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)benzamide.
| Compound Name | N-[(E)-(3-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)benzamide |
|---|---|
| PubChem CID | 137060036 |
| Molecular Formula | C28H21BrN4O3S |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 572.05 |
| IUPAC Name | N-[(E)-(3-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)benzamide |
| SMILES | O=C(N/N=C/c1c(O)c(Br)cc2ccccc12)c1cccc(-n2cnc3sc4c(c3c2=O)CCCC4)c1 |
| InChI | InChI=1S/C28H21BrN4O3S/c29-22-13-16-6-1-2-9-19(16)21(25(22)34)14-31-32-26(35)17-7-5-8-18(12-17)33-15-30-27-24(28(33)36)20-10-3-4-11-23(20)37-27/h1-2,5-9,12-15,34H,3-4,10-11H2,(H,32,35)/b31-14+ |
| InChIKey | DZLYSUSRAQBRQJ-XAZZYMPDSA-N |
| XLogP | 5.71 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|