C33H26N4O2S2 — CID 6891885
N-[(E)-anthracen-9-ylmethylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 6891885) has the molecular formula C33H26N4O2S2 and a molecular weight of 574.73 g/mol. Its IUPAC name is N-[(E)-anthracen-9-ylmethylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6891885 |
| Molecular Formula | C33H26N4O2S2 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2sc3c(c2c(=O)n1-c1ccccc1)CCCC3)N/N=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C33H26N4O2S2/c38-29(36-34-19-27-24-14-6-4-10-21(24)18-22-11-5-7-15-25(22)27)20-40-33-35-31-30(26-16-8-9-17-28(26)41-31)32(39)37(33)23-12-2-1-3-13-23/h1-7,10-15,18-19H,8-9,16-17,20H2,(H,36,38)/b34-19+ |
| InChIKey | OHVXHQOFAAZTKG-ALQBTCKLSA-N |
| XLogP | 6.87 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|