C26H22Cl2N4O3S2 — CID 5186513
N-[(2,6-dichlorophenyl)methylideneamino]-2-[[3-(4-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 5186513) has the molecular formula C26H22Cl2N4O3S2 and a molecular weight of 573.53 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methylideneamino]-2-[[3-(4-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(2,6-dichlorophenyl)methylideneamino]-2-[[3-(4-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 5186513 |
| Molecular Formula | C26H22Cl2N4O3S2 |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 572.05 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methylideneamino]-2-[[3-(4-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)NN=Cc3c(Cl)cccc3Cl)nc3sc4c(c3c2=O)CCCC4)cc1 |
| InChI | InChI=1S/C26H22Cl2N4O3S2/c1-35-16-11-9-15(10-12-16)32-25(34)23-17-5-2-3-8-21(17)37-24(23)30-26(32)36-14-22(33)31-29-13-18-19(27)6-4-7-20(18)28/h4,6-7,9-13H,2-3,5,8,14H2,1H3,(H,31,33) |
| InChIKey | KMRPRPMANQWFEN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|