C27H26N4O5S2 — CID 135752123
N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[3-(4-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 135752123) has the molecular formula C27H26N4O5S2 and a molecular weight of 550.66 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[3-(4-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[3-(4-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135752123 |
| Molecular Formula | C27H26N4O5S2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[3-(4-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)N/N=C/c3cccc(OC)c3O)nc3sc4c(c3c2=O)CCCC4)cc1 |
| InChI | InChI=1S/C27H26N4O5S2/c1-35-18-12-10-17(11-13-18)31-26(34)23-19-7-3-4-9-21(19)38-25(23)29-27(31)37-15-22(32)30-28-14-16-6-5-8-20(36-2)24(16)33/h5-6,8,10-14,33H,3-4,7,9,15H2,1-2H3,(H,30,32)/b28-14+ |
| InChIKey | BRJBVOWWOKNPFX-CCVNUDIWSA-N |
| XLogP | 4.29 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|