C27H24Cl2N4O3S2 — CID 4513250
N-[(2,3-dichlorophenyl)methylideneamino]-2-[[3-(4-ethoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 4513250) has the molecular formula C27H24Cl2N4O3S2 and a molecular weight of 587.55 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methylideneamino]-2-[[3-(4-ethoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(2,3-dichlorophenyl)methylideneamino]-2-[[3-(4-ethoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4513250 |
| Molecular Formula | C27H24Cl2N4O3S2 |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methylideneamino]-2-[[3-(4-ethoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)NN=Cc3cccc(Cl)c3Cl)nc3sc4c(c3c2=O)CCCC4)cc1 |
| InChI | InChI=1S/C27H24Cl2N4O3S2/c1-2-36-18-12-10-17(11-13-18)33-26(35)23-19-7-3-4-9-21(19)38-25(23)31-27(33)37-15-22(34)32-30-14-16-6-5-8-20(28)24(16)29/h5-6,8,10-14H,2-4,7,9,15H2,1H3,(H,32,34) |
| InChIKey | HTKODDBKSBXPMB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|