C17H13Br2N3O2S — CID 137172012
3-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 137172012) has the molecular formula C17H13Br2N3O2S and a molecular weight of 483.19 g/mol. Its IUPAC name is 3-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137172012 |
| Molecular Formula | C17H13Br2N3O2S |
| Molecular Weight | 483.19 g/mol |
| Exact Mass | 480.91 |
| IUPAC Name | 3-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c3c(sc2ncn1/N=C\c1cc(Br)c(O)c(Br)c1)CCCC3 |
| InChI | InChI=1S/C17H13Br2N3O2S/c18-11-5-9(6-12(19)15(11)23)7-21-22-8-20-16-14(17(22)24)10-3-1-2-4-13(10)25-16/h5-8,23H,1-4H2/b21-7- |
| InChIKey | WNNYDPUMASBXGE-YXSASFKJSA-N |
| XLogP | 4.45 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.19 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|