C23H21BrN4OS — CID 126081063
3-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 126081063) has the molecular formula C23H21BrN4OS and a molecular weight of 481.42 g/mol. Its IUPAC name is 3-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 126081063 |
| Molecular Formula | C23H21BrN4OS |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 3-[(E)-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(/C=N/n2cnc3sc4c(c3c2=O)CCCC4)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C23H21BrN4OS/c1-14-10-16(15(2)28(14)18-7-5-6-17(24)11-18)12-26-27-13-25-22-21(23(27)29)19-8-3-4-9-20(19)30-22/h5-7,10-13H,3-4,8-9H2,1-2H3/b26-12+ |
| InChIKey | WWNORLYRUNCVLJ-RPPGKUMJSA-N |
| XLogP | 5.39 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|