C19H17BrN4O3S — CID 1193597
N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 1193597) has the molecular formula C19H17BrN4O3S and a molecular weight of 461.34 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 1193597 |
| Molecular Formula | C19H17BrN4O3S |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2sc3c(c2c1=O)CCCC3)NN=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C19H17BrN4O3S/c20-12-5-6-14(25)11(7-12)8-22-23-16(26)9-24-10-21-18-17(19(24)27)13-3-1-2-4-15(13)28-18/h5-8,10,25H,1-4,9H2,(H,23,26) |
| InChIKey | WBEITAIZMJWICW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|