C21H21BrN4O3S — CID 135769294
(2R)-N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide (PubChem CID 135769294) has the molecular formula C21H21BrN4O3S and a molecular weight of 489.40 g/mol. Its IUPAC name is (2R)-N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide.
| Compound Name | (2R)-N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide |
|---|---|
| PubChem CID | 135769294 |
| Molecular Formula | C21H21BrN4O3S |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | (2R)-N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide |
| SMILES | C[C@H]1CCc2c(sc3ncn([C@H](C)C(=O)N/N=C/c4cc(Br)ccc4O)c(=O)c23)C1 |
| InChI | InChI=1S/C21H21BrN4O3S/c1-11-3-5-15-17(7-11)30-20-18(15)21(29)26(10-23-20)12(2)19(28)25-24-9-13-8-14(22)4-6-16(13)27/h4,6,8-12,27H,3,5,7H2,1-2H3,(H,25,28)/b24-9+/t11-,12+/m0/s1 |
| InChIKey | MNEXANQHOZHRSZ-VSMKJSFNSA-N |
| XLogP | 3.76 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|