C23H26N4O4S — CID 136911465
(2R)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide (PubChem CID 136911465) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is (2R)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide.
| Compound Name | (2R)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide |
|---|---|
| PubChem CID | 136911465 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (2R)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@@H](C)n2cnc3sc4c(c3c2=O)CC[C@@H](C)C4)ccc1O |
| InChI | InChI=1S/C23H26N4O4S/c1-4-31-18-10-15(6-8-17(18)28)11-25-26-21(29)14(3)27-12-24-22-20(23(27)30)16-7-5-13(2)9-19(16)32-22/h6,8,10-14,28H,4-5,7,9H2,1-3H3,(H,26,29)/b25-11-/t13-,14-/m1/s1 |
| InChIKey | PBQKWNLPRXQBRO-HBAACHIQSA-N |
| XLogP | 3.40 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|