C27H25BrN4O3S — CID 4150480
N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 4150480) has the molecular formula C27H25BrN4O3S and a molecular weight of 565.49 g/mol. Its IUPAC name is N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 4150480 |
| Molecular Formula | C27H25BrN4O3S |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | CC1CCc2c(sc3ncn(CC(=O)NN=Cc4cc(Br)ccc4OCc4ccccc4)c(=O)c23)C1 |
| InChI | InChI=1S/C27H25BrN4O3S/c1-17-7-9-21-23(11-17)36-26-25(21)27(34)32(16-29-26)14-24(33)31-30-13-19-12-20(28)8-10-22(19)35-15-18-5-3-2-4-6-18/h2-6,8,10,12-13,16-17H,7,9,11,14-15H2,1H3,(H,31,33) |
| InChIKey | ZHKCEWWCUMUOOQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|