C18H18N4O2S2 — CID 4150592
2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-N-(thiophen-2-ylmethylideneamino)acetamide (PubChem CID 4150592) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-N-(thiophen-2-ylmethylideneamino)acetamide.
| Compound Name | 2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-N-(thiophen-2-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 4150592 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-N-(thiophen-2-ylmethylideneamino)acetamide |
| SMILES | CC1CCc2c(sc3ncn(CC(=O)NN=Cc4cccs4)c(=O)c23)C1 |
| InChI | InChI=1S/C18H18N4O2S2/c1-11-4-5-13-14(7-11)26-17-16(13)18(24)22(10-19-17)9-15(23)21-20-8-12-3-2-6-25-12/h2-3,6,8,10-11H,4-5,7,9H2,1H3,(H,21,23) |
| InChIKey | NAJHPBISLHDWPY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|