C19H19N5O2S — CID 1187504
2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-N-(pyridin-2-ylmethylideneamino)acetamide (PubChem CID 1187504) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-N-(pyridin-2-ylmethylideneamino)acetamide.
| Compound Name | 2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-N-(pyridin-2-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 1187504 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-N-(pyridin-2-ylmethylideneamino)acetamide |
| SMILES | C[C@H]1CCc2c(sc3ncn(CC(=O)NN=Cc4ccccn4)c(=O)c23)C1 |
| InChI | InChI=1S/C19H19N5O2S/c1-12-5-6-14-15(8-12)27-18-17(14)19(26)24(11-21-18)10-16(25)23-22-9-13-4-2-3-7-20-13/h2-4,7,9,11-12H,5-6,8,10H2,1H3,(H,23,25)/t12-/m0/s1 |
| InChIKey | YWJZOVOASJBHEQ-LBPRGKRZSA-N |
| XLogP | 2.13 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|