C22H23BrN4O4S — CID 1193608
N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 1193608) has the molecular formula C22H23BrN4O4S and a molecular weight of 519.42 g/mol. Its IUPAC name is N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 1193608 |
| Molecular Formula | C22H23BrN4O4S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | CCOc1c(Br)cc(C=NNC(=O)Cn2cnc3sc4c(c3c2=O)CCCC4)cc1OC |
| InChI | InChI=1S/C22H23BrN4O4S/c1-3-31-20-15(23)8-13(9-16(20)30-2)10-25-26-18(28)11-27-12-24-21-19(22(27)29)14-6-4-5-7-17(14)32-21/h8-10,12H,3-7,11H2,1-2H3,(H,26,28) |
| InChIKey | NAWTUDMCURZYHX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|