C30H25BrN4O4S — CID 71967302
N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 71967302) has the molecular formula C30H25BrN4O4S and a molecular weight of 617.53 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 71967302 |
| Molecular Formula | C30H25BrN4O4S |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 616.08 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | COc1cc(C=NNC(=O)Cn2cnc3sc(C)c(-c4ccccc4)c3c2=O)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C30H25BrN4O4S/c1-19-26(22-11-7-4-8-12-22)27-29(40-19)32-18-35(30(27)37)16-25(36)34-33-15-21-13-23(31)28(24(14-21)38-2)39-17-20-9-5-3-6-10-20/h3-15,18H,16-17H2,1-2H3,(H,34,36) |
| InChIKey | ZRGYMJFRBPIXBO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|