C30H26N4O4S — CID 6864213
N-[(E)-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 6864213) has the molecular formula C30H26N4O4S and a molecular weight of 538.63 g/mol. Its IUPAC name is N-[(E)-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(E)-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 6864213 |
| Molecular Formula | C30H26N4O4S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | N-[(E)-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cn2cnc3sc(-c4ccccc4)cc3c2=O)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C30H26N4O4S/c1-20-8-10-21(11-9-20)18-38-25-13-12-22(14-26(25)37-2)16-32-33-28(35)17-34-19-31-29-24(30(34)36)15-27(39-29)23-6-4-3-5-7-23/h3-16,19H,17-18H2,1-2H3,(H,33,35)/b32-16+ |
| InChIKey | UXMDLSDUEBNIQS-KPGMTVGESA-N |
| XLogP | 5.17 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|