C21H15N5O4S — CID 6864207
N-[(E)-(4-nitrophenyl)methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 6864207) has the molecular formula C21H15N5O4S and a molecular weight of 433.45 g/mol. Its IUPAC name is N-[(E)-(4-nitrophenyl)methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(E)-(4-nitrophenyl)methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 6864207 |
| Molecular Formula | C21H15N5O4S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-[(E)-(4-nitrophenyl)methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2sc(-c3ccccc3)cc2c1=O)N/N=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H15N5O4S/c27-19(24-23-11-14-6-8-16(9-7-14)26(29)30)12-25-13-22-20-17(21(25)28)10-18(31-20)15-4-2-1-3-5-15/h1-11,13H,12H2,(H,24,27)/b23-11+ |
| InChIKey | ZJMSNODALSARQP-FOKLQQMPSA-N |
| XLogP | 3.18 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|