C21H15N5O5S — CID 135830640
N-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 135830640) has the molecular formula C21H15N5O5S and a molecular weight of 449.45 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 135830640 |
| Molecular Formula | C21H15N5O5S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2scc(-c3ccccc3)c2c1=O)N/N=C\c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H15N5O5S/c27-17-7-6-13(8-16(17)26(30)31)9-23-24-18(28)10-25-12-22-20-19(21(25)29)15(11-32-20)14-4-2-1-3-5-14/h1-9,11-12,27H,10H2,(H,24,28)/b23-9- |
| InChIKey | NWEAKAYKAHKASJ-AQHIEDMUSA-N |
| XLogP | 2.89 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|