C21H16N4O3S — CID 135572062
N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 135572062) has the molecular formula C21H16N4O3S and a molecular weight of 404.45 g/mol. Its IUPAC name is N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 135572062 |
| Molecular Formula | C21H16N4O3S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2sc(-c3ccccc3)cc2c1=O)N/N=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C21H16N4O3S/c26-16-8-6-14(7-9-16)11-23-24-19(27)12-25-13-22-20-17(21(25)28)10-18(29-20)15-4-2-1-3-5-15/h1-11,13,26H,12H2,(H,24,27)/b23-11+ |
| InChIKey | JYPDOVFPCRDSOG-FOKLQQMPSA-N |
| XLogP | 2.98 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|