C22H17FN4O2S — CID 6864080
N-[(E)-(2-fluorophenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 6864080) has the molecular formula C22H17FN4O2S and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[(E)-(2-fluorophenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(E)-(2-fluorophenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 6864080 |
| Molecular Formula | C22H17FN4O2S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[(E)-(2-fluorophenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | Cc1sc2ncn(CC(=O)N/N=C/c3ccccc3F)c(=O)c2c1-c1ccccc1 |
| InChI | InChI=1S/C22H17FN4O2S/c1-14-19(15-7-3-2-4-8-15)20-21(30-14)24-13-27(22(20)29)12-18(28)26-25-11-16-9-5-6-10-17(16)23/h2-11,13H,12H2,1H3,(H,26,28)/b25-11+ |
| InChIKey | ZCASEQAJGWJPPZ-OPEKNORGSA-N |
| XLogP | 3.72 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|