C23H19BrN4O3S — CID 6864075
N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 6864075) has the molecular formula C23H19BrN4O3S and a molecular weight of 511.40 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 6864075 |
| Molecular Formula | C23H19BrN4O3S |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)Cn2cnc3sc(C)c(-c4ccccc4)c3c2=O)cc1Br |
| InChI | InChI=1S/C23H19BrN4O3S/c1-14-20(16-6-4-3-5-7-16)21-22(32-14)25-13-28(23(21)30)12-19(29)27-26-11-15-8-9-18(31-2)17(24)10-15/h3-11,13H,12H2,1-2H3,(H,27,29)/b26-11+ |
| InChIKey | MMSUHYSMOVNBAI-KBKYJPHKSA-N |
| XLogP | 4.35 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|