C17H14Cl2N4O2S — CID 1193592
N-[(3,4-dichlorophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 1193592) has the molecular formula C17H14Cl2N4O2S and a molecular weight of 409.30 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(3,4-dichlorophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 1193592 |
| Molecular Formula | C17H14Cl2N4O2S |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | Cc1sc2ncn(CC(=O)NN=Cc3ccc(Cl)c(Cl)c3)c(=O)c2c1C |
| InChI | InChI=1S/C17H14Cl2N4O2S/c1-9-10(2)26-16-15(9)17(25)23(8-20-16)7-14(24)22-21-6-11-3-4-12(18)13(19)5-11/h3-6,8H,7H2,1-2H3,(H,22,24) |
| InChIKey | JPGIKCOINCCCAC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|