C17H14N2O2S — CID 66553668
3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)benzaldehyde (PubChem CID 66553668) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)benzaldehyde.
| Compound Name | 3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 66553668 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)benzaldehyde |
| SMILES | O=Cc1cccc(-n2cnc3sc4c(c3c2=O)CCCC4)c1 |
| InChI | InChI=1S/C17H14N2O2S/c20-9-11-4-3-5-12(8-11)19-10-18-16-15(17(19)21)13-6-1-2-7-14(13)22-16/h3-5,8-10H,1-2,6-7H2 |
| InChIKey | XXKAMWGQRJKSQO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|