C23H21BrN4O6 — CID 136886622
(2R)-2-[(E)-(4-bromophenyl)methylideneamino]oxy-N-[(Z)-(2-hydroxy-3-nitro-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]propanamide (PubChem CID 136886622) has the molecular formula C23H21BrN4O6 and a molecular weight of 529.35 g/mol. Its IUPAC name is (2R)-2-[(E)-(4-bromophenyl)methylideneamino]oxy-N-[(Z)-(2-hydroxy-3-nitro-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]propanamide.
| Compound Name | (2R)-2-[(E)-(4-bromophenyl)methylideneamino]oxy-N-[(Z)-(2-hydroxy-3-nitro-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 136886622 |
| Molecular Formula | C23H21BrN4O6 |
| Molecular Weight | 529.35 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | (2R)-2-[(E)-(4-bromophenyl)methylideneamino]oxy-N-[(Z)-(2-hydroxy-3-nitro-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]propanamide |
| SMILES | C[C@@H](O/N=C/c1ccc(Br)cc1)C(=O)N/N=C\c1c(O)c([N+](=O)[O-])cc2oc3c(c12)CCCC3 |
| InChI | InChI=1S/C23H21BrN4O6/c1-13(34-26-11-14-6-8-15(24)9-7-14)23(30)27-25-12-17-21-16-4-2-3-5-19(16)33-20(21)10-18(22(17)29)28(31)32/h6-13,29H,2-5H2,1H3,(H,27,30)/b25-12-,26-11+/t13-/m1/s1 |
| InChIKey | CASQDOBCOVUNRP-HRTPNFAPSA-N |
| XLogP | 4.58 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|