C27H32N2O5 — CID 171976999
1-[(3,5-ditert-butyl-2-hydroxyphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-ol (PubChem CID 171976999) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is 1-[(3,5-ditert-butyl-2-hydroxyphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-ol.
| Compound Name | 1-[(3,5-ditert-butyl-2-hydroxyphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-ol |
|---|---|
| PubChem CID | 171976999 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 1-[(3,5-ditert-butyl-2-hydroxyphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-ol |
| SMILES | CC(C)(C)c1cc(/N=C/c2c(O)c([N+](=O)[O-])cc3oc4c(c23)CCCC4)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H32N2O5/c1-26(2,3)15-11-18(27(4,5)6)25(31)19(12-15)28-14-17-23-16-9-7-8-10-21(16)34-22(23)13-20(24(17)30)29(32)33/h11-14,30-31H,7-10H2,1-6H3/b28-14+ |
| InChIKey | BJBJZUYWUHIAPF-CCVNUDIWSA-N |
| XLogP | 6.98 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|