C28H33NO4S — CID 135648536
ethyl 2-[(E)-(3-tert-butyl-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 135648536) has the molecular formula C28H33NO4S and a molecular weight of 479.64 g/mol. Its IUPAC name is ethyl 2-[(E)-(3-tert-butyl-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(E)-(3-tert-butyl-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135648536 |
| Molecular Formula | C28H33NO4S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | ethyl 2-[(E)-(3-tert-butyl-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(/N=C/c2c(O)c(C(C)(C)C)cc3oc4c(c23)CCCC4)sc2c1CCCC2 |
| InChI | InChI=1S/C28H33NO4S/c1-5-32-27(31)24-17-11-7-9-13-22(17)34-26(24)29-15-18-23-16-10-6-8-12-20(16)33-21(23)14-19(25(18)30)28(2,3)4/h14-15,30H,5-13H2,1-4H3/b29-15+ |
| InChIKey | SRIFLMADXBSYJW-WKULSOCRSA-N |
| XLogP | 7.18 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|