C23H22N2O5 — CID 171976854
[1-[(2,4-dimethylphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-yl] acetate (PubChem CID 171976854) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is [1-[(2,4-dimethylphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-yl] acetate.
| Compound Name | [1-[(2,4-dimethylphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-yl] acetate |
|---|---|
| PubChem CID | 171976854 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [1-[(2,4-dimethylphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-yl] acetate |
| SMILES | CC(=O)Oc1c([N+](=O)[O-])cc2oc3c(c2c1/C=N/c1ccc(C)cc1C)CCCC3 |
| InChI | InChI=1S/C23H22N2O5/c1-13-8-9-18(14(2)10-13)24-12-17-22-16-6-4-5-7-20(16)30-21(22)11-19(25(27)28)23(17)29-15(3)26/h8-12H,4-7H2,1-3H3/b24-12+ |
| InChIKey | MTJQODLXOWBHIK-WYMPLXKRSA-N |
| XLogP | 5.51 |
| TPSA | 94.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|