C18H12N2O8 — CID 1418956
(3-benzoyl-2-methyl-4,6-dinitro-1-benzofuran-5-yl) acetate (PubChem CID 1418956) has the molecular formula C18H12N2O8 and a molecular weight of 384.30 g/mol. Its IUPAC name is (3-benzoyl-2-methyl-4,6-dinitro-1-benzofuran-5-yl) acetate.
| Compound Name | (3-benzoyl-2-methyl-4,6-dinitro-1-benzofuran-5-yl) acetate |
|---|---|
| PubChem CID | 1418956 |
| Molecular Formula | C18H12N2O8 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | (3-benzoyl-2-methyl-4,6-dinitro-1-benzofuran-5-yl) acetate |
| SMILES | CC(=O)Oc1c([N+](=O)[O-])cc2oc(C)c(C(=O)c3ccccc3)c2c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12N2O8/c1-9-14(17(22)11-6-4-3-5-7-11)15-13(27-9)8-12(19(23)24)18(28-10(2)21)16(15)20(25)26/h3-8H,1-2H3 |
| InChIKey | YNLIXHTYZGVNMO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 142.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|