About [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate
[4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate (PubChem CID 173323607) has the molecular formula C23H18N2O5
and a molecular weight of 402.41 g/mol. Its IUPAC name is [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate.
Molecular Properties
| Compound Name | [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate |
| PubChem CID | 173323607 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate |
| SMILES | CC(=O)Oc1c(-c2ccccc2)cc(C=CC(N)=O)c(-c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H18N2O5/c1-15(26)30-23-19(16-8-4-2-5-9-16)14-18(12-13-20(24)27)21(22(23)25(28)29)17-10-6-3-7-11-17/h2-14H,1H3,(H2,24,27) |
| InChIKey | DPHCQQSOGAZDOB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate?
The IUPAC name of [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate (CID 173323607) is [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate.
What is the SMILES notation for [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate?
The canonical SMILES for [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate is CC(=O)Oc1c(-c2ccccc2)cc(C=CC(N)=O)c(-c2ccccc2)c1[N+](=O)[O-].
What is the InChIKey of [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate?
The InChIKey is DPHCQQSOGAZDOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O5/c1-15(26)30-23-19(16-8-4-2-5-9-16)14-18(12-13-20(24)27)21(22(23)25(28)29)17-10-6-3-7-11-17/h2-14H,1H3,(H2,24,27).
What are the key properties of [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate?
[4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate has a molecular weight of 402.41 g/mol, XLogP of 4.35, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-amino-3-oxoprop-1-enyl)-2-nitro-3,6-diphenylphenyl] acetate is sourced from PubChem (CID 173323607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).