C31H39N3O2 — CID 135437706
3-tert-butyl-1-[(E)-(1-heptylbenzimidazol-2-yl)iminomethyl]-6,7,8,9-tetrahydrodibenzofuran-2-ol (PubChem CID 135437706) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is 3-tert-butyl-1-[(E)-(1-heptylbenzimidazol-2-yl)iminomethyl]-6,7,8,9-tetrahydrodibenzofuran-2-ol.
| Compound Name | 3-tert-butyl-1-[(E)-(1-heptylbenzimidazol-2-yl)iminomethyl]-6,7,8,9-tetrahydrodibenzofuran-2-ol |
|---|---|
| PubChem CID | 135437706 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 3-tert-butyl-1-[(E)-(1-heptylbenzimidazol-2-yl)iminomethyl]-6,7,8,9-tetrahydrodibenzofuran-2-ol |
| SMILES | CCCCCCCn1c(/N=C/c2c(O)c(C(C)(C)C)cc3oc4c(c23)CCCC4)nc2ccccc21 |
| InChI | InChI=1S/C31H39N3O2/c1-5-6-7-8-13-18-34-25-16-11-10-15-24(25)33-30(34)32-20-22-28-21-14-9-12-17-26(21)36-27(28)19-23(29(22)35)31(2,3)4/h10-11,15-16,19-20,35H,5-9,12-14,17-18H2,1-4H3/b32-20+ |
| InChIKey | SERIRDGCAPIVKX-UZWMFBFFSA-N |
| XLogP | 8.39 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|