C25H26BrN3O — CID 135606674
6-bromo-1-[(E)-(1-heptylbenzimidazol-2-yl)iminomethyl]naphthalen-2-ol (PubChem CID 135606674) has the molecular formula C25H26BrN3O and a molecular weight of 464.41 g/mol. Its IUPAC name is 6-bromo-1-[(E)-(1-heptylbenzimidazol-2-yl)iminomethyl]naphthalen-2-ol.
| Compound Name | 6-bromo-1-[(E)-(1-heptylbenzimidazol-2-yl)iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135606674 |
| Molecular Formula | C25H26BrN3O |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 6-bromo-1-[(E)-(1-heptylbenzimidazol-2-yl)iminomethyl]naphthalen-2-ol |
| SMILES | CCCCCCCn1c(/N=C/c2c(O)ccc3cc(Br)ccc23)nc2ccccc21 |
| InChI | InChI=1S/C25H26BrN3O/c1-2-3-4-5-8-15-29-23-10-7-6-9-22(23)28-25(29)27-17-21-20-13-12-19(26)16-18(20)11-14-24(21)30/h6-7,9-14,16-17,30H,2-5,8,15H2,1H3/b27-17+ |
| InChIKey | BOANZMCHWBCNPE-WPWMEQJKSA-N |
| XLogP | 7.38 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|